C22H38N2O7 — CID 123598555
(2,5-dihydroxypyrrol-1-yl) 6-methyl-6-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]heptanoate (PubChem CID 123598555) has the molecular formula C22H38N2O7 and a molecular weight of 442.55 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-methyl-6-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]heptanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-methyl-6-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]heptanoate |
|---|---|
| PubChem CID | 123598555 |
| Molecular Formula | C22H38N2O7 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-methyl-6-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]heptanoate |
| SMILES | CC(C)(CCOC(C)(C)CCCCC(=O)On1c(O)ccc1O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H38N2O7/c1-20(2,3)30-19(28)23-21(4,5)14-15-29-22(6,7)13-9-8-10-18(27)31-24-16(25)11-12-17(24)26/h11-12,25-26H,8-10,13-15H2,1-7H3,(H,23,28) |
| InChIKey | MDUGAPCHCHYNMP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|