C32H39F2NO5 — CID 123602120
1,9-difluoro-18-hydroxy-15-(2-hydroxyacetyl)-14-[[hydroxy(3-phenylpropyl)amino]methyl]-2,16-dimethyltetracyclo[9.7.0.02,8.012,16]octadeca-3,6,7-trien-5-one (PubChem CID 123602120) has the molecular formula C32H39F2NO5 and a molecular weight of 555.66 g/mol. Its IUPAC name is 1,9-difluoro-18-hydroxy-15-(2-hydroxyacetyl)-14-[[hydroxy(3-phenylpropyl)amino]methyl]-2,16-dimethyltetracyclo[9.7.0.02,8.012,16]octadeca-3,6,7-trien-5-one.
| Compound Name | 1,9-difluoro-18-hydroxy-15-(2-hydroxyacetyl)-14-[[hydroxy(3-phenylpropyl)amino]methyl]-2,16-dimethyltetracyclo[9.7.0.02,8.012,16]octadeca-3,6,7-trien-5-one |
|---|---|
| PubChem CID | 123602120 |
| Molecular Formula | C32H39F2NO5 |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | 1,9-difluoro-18-hydroxy-15-(2-hydroxyacetyl)-14-[[hydroxy(3-phenylpropyl)amino]methyl]-2,16-dimethyltetracyclo[9.7.0.02,8.012,16]octadeca-3,6,7-trien-5-one |
| SMILES | CC12CC(O)C3(F)C(CC(F)C4=C=CC(=O)C=CC43C)C1CC(CN(O)CCCc1ccccc1)C2C(=O)CO |
| InChI | InChI=1S/C32H39F2NO5/c1-30-17-28(39)32(34)25(16-26(33)23-11-10-22(37)12-13-31(23,32)2)24(30)15-21(29(30)27(38)19-36)18-35(40)14-6-9-20-7-4-3-5-8-20/h3-5,7-8,10,12-13,21,24-26,28-29,36,39-40H,6,9,14-19H2,1-2H3 |
| InChIKey | RQLAPJZNWIPLFE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|