C25H26O3 — CID 123603624
(1S,2R,6S,7R,8R)-8-(4-methylphenyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123603624) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is (1S,2R,6S,7R,8R)-8-(4-methylphenyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8R)-8-(4-methylphenyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123603624 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (1S,2R,6S,7R,8R)-8-(4-methylphenyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1ccc([C@H]2C[C@@H]3O[C@H]2[C@H]2C(=O)C(c4c(C)cc(C)cc4C)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C25H26O3/c1-12-5-7-16(8-6-12)17-11-18-20-22(25(17)28-18)24(27)21(23(20)26)19-14(3)9-13(2)10-15(19)4/h5-10,17-18,20-22,25H,11H2,1-4H3/t17-,18+,20+,21?,22-,25-/m1/s1 |
| InChIKey | VIWSODMVOYXJOT-COMSEIAWSA-N |
| XLogP | 4.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|