C25H32N4O3S — CID 123604327
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[4-hydroxybutyl-(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide (PubChem CID 123604327) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[4-hydroxybutyl-(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[4-hydroxybutyl-(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 123604327 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[4-hydroxybutyl-(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide |
| SMILES | Nc1nc(CC(=O)Nc2ccc(CCN(CCCCO)CC(O)c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C25H32N4O3S/c26-25-28-22(18-33-25)16-24(32)27-21-10-8-19(9-11-21)12-14-29(13-4-5-15-30)17-23(31)20-6-2-1-3-7-20/h1-3,6-11,18,23,30-31H,4-5,12-17H2,(H2,26,28)(H,27,32) |
| InChIKey | IGDXMEBSFGUPGD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|