C19H24N4O3S — CID 167005217
2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethyl-pent-4-enylcarbamic acid (PubChem CID 167005217) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethyl-pent-4-enylcarbamic acid.
| Compound Name | 2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethyl-pent-4-enylcarbamic acid |
|---|---|
| PubChem CID | 167005217 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethyl-pent-4-enylcarbamic acid |
| SMILES | C=CCCCN(CCc1ccc(NC(=O)Cc2csc(N)n2)cc1)C(=O)O |
| InChI | InChI=1S/C19H24N4O3S/c1-2-3-4-10-23(19(25)26)11-9-14-5-7-15(8-6-14)21-17(24)12-16-13-27-18(20)22-16/h2,5-8,13H,1,3-4,9-12H2,(H2,20,22)(H,21,24)(H,25,26) |
| InChIKey | NFGMGCCQPGJZRW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|