C20H34 — CID 123604594
1,2,4,4-tetramethyl-5-[(2,5,5-trimethylcyclohexen-1-yl)methyl]cyclohexene (PubChem CID 123604594) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 1,2,4,4-tetramethyl-5-[(2,5,5-trimethylcyclohexen-1-yl)methyl]cyclohexene.
| Compound Name | 1,2,4,4-tetramethyl-5-[(2,5,5-trimethylcyclohexen-1-yl)methyl]cyclohexene |
|---|---|
| PubChem CID | 123604594 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 1,2,4,4-tetramethyl-5-[(2,5,5-trimethylcyclohexen-1-yl)methyl]cyclohexene |
| SMILES | CC1=C(C)CC(C)(C)C(CC2=C(C)CCC(C)(C)C2)C1 |
| InChI | InChI=1S/C20H34/c1-14-8-9-19(4,5)13-17(14)11-18-10-15(2)16(3)12-20(18,6)7/h18H,8-13H2,1-7H3 |
| InChIKey | UKZJGPABMKSBOG-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|