C17H21N — CID 123608175
(2Z,5E)-N-(3-ethenyl-7-bicyclo[4.1.0]hepta-1,6-dienyl)octa-2,5-dien-4-imine (PubChem CID 123608175) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (2Z,5E)-N-(3-ethenyl-7-bicyclo[4.1.0]hepta-1,6-dienyl)octa-2,5-dien-4-imine.
| Compound Name | (2Z,5E)-N-(3-ethenyl-7-bicyclo[4.1.0]hepta-1,6-dienyl)octa-2,5-dien-4-imine |
|---|---|
| PubChem CID | 123608175 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (2Z,5E)-N-(3-ethenyl-7-bicyclo[4.1.0]hepta-1,6-dienyl)octa-2,5-dien-4-imine |
| SMILES | C=CC1C=C2C(=C2/N=C(\C=C/C)/C=C/CC)CC1 |
| InChI | InChI=1S/C17H21N/c1-4-7-9-14(8-5-2)18-17-15-11-10-13(6-3)12-16(15)17/h5-9,12-13H,3-4,10-11H2,1-2H3/b8-5-,9-7+,18-14+ |
| InChIKey | VHHGGZSVPWUYJJ-MKEHKKBDSA-N |
| XLogP | 4.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|