C6H20OSi3 — CID 123608363
[dimethylsilyl(methyl)silyl]oxy-trimethylsilane (PubChem CID 123608363) has the molecular formula C6H20OSi3 and a molecular weight of 192.48 g/mol. Its IUPAC name is [dimethylsilyl(methyl)silyl]oxy-trimethylsilane.
| Compound Name | [dimethylsilyl(methyl)silyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 123608363 |
| Molecular Formula | C6H20OSi3 |
| Molecular Weight | 192.48 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | [dimethylsilyl(methyl)silyl]oxy-trimethylsilane |
| SMILES | C[SiH](C)[SiH](C)O[Si](C)(C)C |
| InChI | InChI=1S/C6H20OSi3/c1-8(2)9(3)7-10(4,5)6/h8-9H,1-6H3 |
| InChIKey | JJTNEQTXWJKGLO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|