About bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene
bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene (PubChem CID 173162539) has the molecular formula C12H32O3Si4
and a molecular weight of 336.73 g/mol. Its IUPAC name is bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene.
Molecular Properties
| Compound Name | bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene |
| PubChem CID | 173162539 |
| Molecular Formula | C12H32O3Si4 |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene |
| SMILES | C=C=C.C[Si](C)(C)O[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H28O3Si4.C3H4/c1-14(2,3)10-13(11-15(4,5)6)12-16(7,8)9;1-3-2/h13H,1-9H3;1-2H2 |
| InChIKey | PQLYTQRJGOGOAM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene?
The IUPAC name of bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene (CID 173162539) is bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene.
What is the SMILES notation for bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene?
The canonical SMILES for bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene is C=C=C.C[Si](C)(C)O[SiH](O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene?
The InChIKey is PQLYTQRJGOGOAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H28O3Si4.C3H4/c1-14(2,3)10-13(11-15(4,5)6)12-16(7,8)9;1-3-2/h13H,1-9H3;1-2H2.
What are the key properties of bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene?
bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene has a molecular weight of 336.73 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyloxy)silyloxy-trimethylsilane;propa-1,2-diene is sourced from PubChem (CID 173162539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).