C9H28O2Si4 — CID 154073043
trimethyl-[methyl-[[methyl(trimethylsilyloxy)silyl]methyl]silyl]oxysilane (PubChem CID 154073043) has the molecular formula C9H28O2Si4 and a molecular weight of 280.67 g/mol. Its IUPAC name is trimethyl-[methyl-[[methyl(trimethylsilyloxy)silyl]methyl]silyl]oxysilane.
| Compound Name | trimethyl-[methyl-[[methyl(trimethylsilyloxy)silyl]methyl]silyl]oxysilane |
|---|---|
| PubChem CID | 154073043 |
| Molecular Formula | C9H28O2Si4 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | trimethyl-[methyl-[[methyl(trimethylsilyloxy)silyl]methyl]silyl]oxysilane |
| SMILES | C[SiH](C[SiH](C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H28O2Si4/c1-12(10-14(3,4)5)9-13(2)11-15(6,7)8/h12-13H,9H2,1-8H3 |
| InChIKey | XVBZDCTZQZTZOO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|