C14H36N2OSi2 — CID 175437207
10-[methyl(trimethylsilyloxy)silyl]decane-1,1-diamine (PubChem CID 175437207) has the molecular formula C14H36N2OSi2 and a molecular weight of 304.63 g/mol. Its IUPAC name is 10-[methyl(trimethylsilyloxy)silyl]decane-1,1-diamine.
| Compound Name | 10-[methyl(trimethylsilyloxy)silyl]decane-1,1-diamine |
|---|---|
| PubChem CID | 175437207 |
| Molecular Formula | C14H36N2OSi2 |
| Molecular Weight | 304.63 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 10-[methyl(trimethylsilyloxy)silyl]decane-1,1-diamine |
| SMILES | C[SiH](CCCCCCCCCC(N)N)O[Si](C)(C)C |
| InChI | InChI=1S/C14H36N2OSi2/c1-18(17-19(2,3)4)13-11-9-7-5-6-8-10-12-14(15)16/h14,18H,5-13,15-16H2,1-4H3 |
| InChIKey | YLUIUVJATWZDIK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|