C21H49N3O2 — CID 175555484
decan-1-amine;decane-1,1-diamine;formic acid (PubChem CID 175555484) has the molecular formula C21H49N3O2 and a molecular weight of 375.64 g/mol. Its IUPAC name is decan-1-amine;decane-1,1-diamine;formic acid.
| Compound Name | decan-1-amine;decane-1,1-diamine;formic acid |
|---|---|
| PubChem CID | 175555484 |
| Molecular Formula | C21H49N3O2 |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 375.38 |
| IUPAC Name | decan-1-amine;decane-1,1-diamine;formic acid |
| SMILES | CCCCCCCCCC(N)N.CCCCCCCCCCN.O=CO |
| InChI | InChI=1S/C10H24N2.C10H23N.CH2O2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8-9-10-11;2-1-3/h10H,2-9,11-12H2,1H3;2-11H2,1H3;1H,(H,2,3) |
| InChIKey | RJPFCJJJVOHGGV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|