C24H38O2 — CID 123609983
tert-butyl 6-[2-(2,4-dimethylphenyl)ethyl]-2-methylidenenonanoate (PubChem CID 123609983) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is tert-butyl 6-[2-(2,4-dimethylphenyl)ethyl]-2-methylidenenonanoate.
| Compound Name | tert-butyl 6-[2-(2,4-dimethylphenyl)ethyl]-2-methylidenenonanoate |
|---|---|
| PubChem CID | 123609983 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | tert-butyl 6-[2-(2,4-dimethylphenyl)ethyl]-2-methylidenenonanoate |
| SMILES | C=C(CCCC(CCC)CCc1ccc(C)cc1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38O2/c1-8-10-21(14-16-22-15-13-18(2)17-20(22)4)12-9-11-19(3)23(25)26-24(5,6)7/h13,15,17,21H,3,8-12,14,16H2,1-2,4-7H3 |
| InChIKey | USCXVZJDXMUXJO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|