C19H18N2O3 — CID 123611133
4-benzoyl-5-propan-2-yl-1-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 123611133) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-benzoyl-5-propan-2-yl-1-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | 4-benzoyl-5-propan-2-yl-1-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123611133 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 4-benzoyl-5-propan-2-yl-1-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | CC(C)C1C(C(=O)c2ccccc2)C(=O)C(=O)N1c1ccccn1 |
| InChI | InChI=1S/C19H18N2O3/c1-12(2)16-15(17(22)13-8-4-3-5-9-13)18(23)19(24)21(16)14-10-6-7-11-20-14/h3-12,15-16H,1-2H3 |
| InChIKey | NSTYSPBEIYOTEB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|