C15H22O — CID 123617028
5-(4-propan-2-ylcyclohex-3-en-1-yl)oxycyclohexa-1,3-diene (PubChem CID 123617028) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 5-(4-propan-2-ylcyclohex-3-en-1-yl)oxycyclohexa-1,3-diene.
| Compound Name | 5-(4-propan-2-ylcyclohex-3-en-1-yl)oxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123617028 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 5-(4-propan-2-ylcyclohex-3-en-1-yl)oxycyclohexa-1,3-diene |
| SMILES | CC(C)C1=CCC(OC2C=CC=CC2)CC1 |
| InChI | InChI=1S/C15H22O/c1-12(2)13-8-10-15(11-9-13)16-14-6-4-3-5-7-14/h3-6,8,12,14-15H,7,9-11H2,1-2H3 |
| InChIKey | ZNDDTKWWAKOVPQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|