C14H22O — CID 123602198
cyclohexa-2,4-dien-1-yloxycyclooctane (PubChem CID 123602198) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-yloxycyclooctane.
| Compound Name | cyclohexa-2,4-dien-1-yloxycyclooctane |
|---|---|
| PubChem CID | 123602198 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | cyclohexa-2,4-dien-1-yloxycyclooctane |
| SMILES | C1=CCC(OC2CCCCCCC2)C=C1 |
| InChI | InChI=1S/C14H22O/c1-2-5-9-13(10-6-3-1)15-14-11-7-4-8-12-14/h4,7-8,11,13-14H,1-3,5-6,9-10,12H2 |
| InChIKey | WXRZWRYBOXGKGR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |