C12H18N2 — CID 5232523
cyclohexa-2,4-dien-1-yl(cyclohexyl)diazene (PubChem CID 5232523) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-yl(cyclohexyl)diazene.
| Compound Name | cyclohexa-2,4-dien-1-yl(cyclohexyl)diazene |
|---|---|
| PubChem CID | 5232523 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | cyclohexa-2,4-dien-1-yl(cyclohexyl)diazene |
| SMILES | C1=CCC(/N=N/C2CCCCC2)C=C1 |
| InChI | InChI=1S/C12H18N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1,3-4,7,11-12H,2,5-6,8-10H2/b14-13+ |
| InChIKey | VJIMWBXTDFKTKP-BUHFOSPRSA-N |
| XLogP | 3.66 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|