C24H32O3S — CID 144724995
cyclohexa-2,4-dien-1-yl 2,5-dicyclohexylbenzenesulfonate (PubChem CID 144724995) has the molecular formula C24H32O3S and a molecular weight of 400.58 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-yl 2,5-dicyclohexylbenzenesulfonate.
| Compound Name | cyclohexa-2,4-dien-1-yl 2,5-dicyclohexylbenzenesulfonate |
|---|---|
| PubChem CID | 144724995 |
| Molecular Formula | C24H32O3S |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | cyclohexa-2,4-dien-1-yl 2,5-dicyclohexylbenzenesulfonate |
| SMILES | O=S(=O)(OC1C=CC=CC1)c1cc(C2CCCCC2)ccc1C1CCCCC1 |
| InChI | InChI=1S/C24H32O3S/c25-28(26,27-22-14-8-3-9-15-22)24-18-21(19-10-4-1-5-11-19)16-17-23(24)20-12-6-2-7-13-20/h3,8-9,14,16-20,22H,1-2,4-7,10-13,15H2 |
| InChIKey | SJIMXDITAZDYNF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|