C24H30N4 — CID 123617308
14-ethyl-8-methyl-11-(4-methylpiperazin-1-yl)-1-azatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,10,12,15-hexaene-4-carbonitrile (PubChem CID 123617308) has the molecular formula C24H30N4 and a molecular weight of 374.53 g/mol. Its IUPAC name is 14-ethyl-8-methyl-11-(4-methylpiperazin-1-yl)-1-azatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,10,12,15-hexaene-4-carbonitrile.
| Compound Name | 14-ethyl-8-methyl-11-(4-methylpiperazin-1-yl)-1-azatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,10,12,15-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 123617308 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 14-ethyl-8-methyl-11-(4-methylpiperazin-1-yl)-1-azatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,10,12,15-hexaene-4-carbonitrile |
| SMILES | CCC1C=CN2C(=C1)C(N1CCN(C)CC1)=CCC(C)c1ccc(C#N)cc12 |
| InChI | InChI=1S/C24H30N4/c1-4-19-9-10-28-23-16-20(17-25)6-7-21(23)18(2)5-8-22(24(28)15-19)27-13-11-26(3)12-14-27/h6-10,15-16,18-19H,4-5,11-14H2,1-3H3 |
| InChIKey | WYFRAZWLCYGAIL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 33.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |