C20H24ClN3O — CID 123939887
14-chloro-4,10-dimethyl-7-(4-methylpiperazin-1-yl)-3-oxa-5-azatricyclo[9.4.0.02,6]pentadeca-1(11),2(6),4,7,12,14-hexaene (PubChem CID 123939887) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is 14-chloro-4,10-dimethyl-7-(4-methylpiperazin-1-yl)-3-oxa-5-azatricyclo[9.4.0.02,6]pentadeca-1(11),2(6),4,7,12,14-hexaene.
| Compound Name | 14-chloro-4,10-dimethyl-7-(4-methylpiperazin-1-yl)-3-oxa-5-azatricyclo[9.4.0.02,6]pentadeca-1(11),2(6),4,7,12,14-hexaene |
|---|---|
| PubChem CID | 123939887 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 14-chloro-4,10-dimethyl-7-(4-methylpiperazin-1-yl)-3-oxa-5-azatricyclo[9.4.0.02,6]pentadeca-1(11),2(6),4,7,12,14-hexaene |
| SMILES | Cc1nc2c(o1)-c1cc(Cl)ccc1C(C)CC=C2N1CCN(C)CC1 |
| InChI | InChI=1S/C20H24ClN3O/c1-13-4-7-18(24-10-8-23(3)9-11-24)19-20(25-14(2)22-19)17-12-15(21)5-6-16(13)17/h5-7,12-13H,4,8-11H2,1-3H3 |
| InChIKey | YONBNCCMXZACDM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |