C19H23ClN4 — CID 123451297
14-chloro-10-methyl-7-(4-methylpiperazin-1-yl)-5,6-diazatricyclo[9.4.0.02,6]pentadeca-1(11),2,4,7,12,14-hexaene (PubChem CID 123451297) has the molecular formula C19H23ClN4 and a molecular weight of 342.87 g/mol. Its IUPAC name is 14-chloro-10-methyl-7-(4-methylpiperazin-1-yl)-5,6-diazatricyclo[9.4.0.02,6]pentadeca-1(11),2,4,7,12,14-hexaene.
| Compound Name | 14-chloro-10-methyl-7-(4-methylpiperazin-1-yl)-5,6-diazatricyclo[9.4.0.02,6]pentadeca-1(11),2,4,7,12,14-hexaene |
|---|---|
| PubChem CID | 123451297 |
| Molecular Formula | C19H23ClN4 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 14-chloro-10-methyl-7-(4-methylpiperazin-1-yl)-5,6-diazatricyclo[9.4.0.02,6]pentadeca-1(11),2,4,7,12,14-hexaene |
| SMILES | CC1CC=C(N2CCN(C)CC2)n2nccc2-c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H23ClN4/c1-14-3-6-19(23-11-9-22(2)10-12-23)24-18(7-8-21-24)17-13-15(20)4-5-16(14)17/h4-8,13-14H,3,9-12H2,1-2H3 |
| InChIKey | WKZBJWBZHGFYKH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |