C20H24ClN3 — CID 174382709
1-(3-chlorophenyl)-4-methylpiperazine;tricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-amine (PubChem CID 174382709) has the molecular formula C20H24ClN3 and a molecular weight of 341.89 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-methylpiperazine;tricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-amine.
| Compound Name | 1-(3-chlorophenyl)-4-methylpiperazine;tricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-amine |
|---|---|
| PubChem CID | 174382709 |
| Molecular Formula | C20H24ClN3 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-(3-chlorophenyl)-4-methylpiperazine;tricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-amine |
| SMILES | CN1CCN(c2cccc(Cl)c2)CC1.Nc1ccc2c(c1)C1CC21 |
| InChI | InChI=1S/C11H15ClN2.C9H9N/c1-13-5-7-14(8-6-13)11-4-2-3-10(12)9-11;10-5-1-2-6-7(3-5)9-4-8(6)9/h2-4,9H,5-8H2,1H3;1-3,8-9H,4,10H2 |
| InChIKey | CWVAFOKOGLNJMC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|