C13H30Si — CID 123619761
2,2-dimethylpropyl-bis(2-methylpropyl)silane (PubChem CID 123619761) has the molecular formula C13H30Si and a molecular weight of 214.47 g/mol. Its IUPAC name is 2,2-dimethylpropyl-bis(2-methylpropyl)silane.
| Compound Name | 2,2-dimethylpropyl-bis(2-methylpropyl)silane |
|---|---|
| PubChem CID | 123619761 |
| Molecular Formula | C13H30Si |
| Molecular Weight | 214.47 g/mol |
| Exact Mass | 214.21 |
| IUPAC Name | 2,2-dimethylpropyl-bis(2-methylpropyl)silane |
| SMILES | CC(C)C[SiH](CC(C)C)CC(C)(C)C |
| InChI | InChI=1S/C13H30Si/c1-11(2)8-14(9-12(3)4)10-13(5,6)7/h11-12,14H,8-10H2,1-7H3 |
| InChIKey | SCQDKQJLUBAEHS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|