C11H9N3O3S — CID 123624656
9-methyl-7-oxo-5-thia-1,8,12-triazatricyclo[8.3.0.02,6]trideca-2(6),3,10,12-tetraene-11-carboxylic acid (PubChem CID 123624656) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 9-methyl-7-oxo-5-thia-1,8,12-triazatricyclo[8.3.0.02,6]trideca-2(6),3,10,12-tetraene-11-carboxylic acid.
| Compound Name | 9-methyl-7-oxo-5-thia-1,8,12-triazatricyclo[8.3.0.02,6]trideca-2(6),3,10,12-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 123624656 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 9-methyl-7-oxo-5-thia-1,8,12-triazatricyclo[8.3.0.02,6]trideca-2(6),3,10,12-tetraene-11-carboxylic acid |
| SMILES | CC1NC(=O)c2sccc2-n2cnc(C(=O)O)c21 |
| InChI | InChI=1S/C11H9N3O3S/c1-5-8-7(11(16)17)12-4-14(8)6-2-3-18-9(6)10(15)13-5/h2-5H,1H3,(H,13,15)(H,16,17) |
| InChIKey | IGFLBYJCTOWBFY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |