C8H11N3 — CID 123625225
5,6-dihydro-1H-benzimidazol-2-ylmethanamine (PubChem CID 123625225) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 5,6-dihydro-1H-benzimidazol-2-ylmethanamine.
| Compound Name | 5,6-dihydro-1H-benzimidazol-2-ylmethanamine |
|---|---|
| PubChem CID | 123625225 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 5,6-dihydro-1H-benzimidazol-2-ylmethanamine |
| SMILES | NCc1nc2c([nH]1)=CCCC=2 |
| InChI | InChI=1S/C8H11N3/c9-5-8-10-6-3-1-2-4-7(6)11-8/h3-4H,1-2,5,9H2,(H,10,11) |
| InChIKey | LZKZYNDBDDMAJX-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |