C23H30N2O2 — CID 123625762
N-[4-[2-[2-(C-ethyl-N-methylcarbonimidoyl)phenoxy]ethyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 123625762) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[4-[2-[2-(C-ethyl-N-methylcarbonimidoyl)phenoxy]ethyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[2-[2-(C-ethyl-N-methylcarbonimidoyl)phenoxy]ethyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 123625762 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[4-[2-[2-(C-ethyl-N-methylcarbonimidoyl)phenoxy]ethyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC/C(=N\C)c1ccccc1OCCc1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O2/c1-6-20(24-5)19-9-7-8-10-21(19)27-16-15-17-11-13-18(14-12-17)25-22(26)23(2,3)4/h7-14H,6,15-16H2,1-5H3,(H,25,26)/b24-20+ |
| InChIKey | XFBONFSSNVTKIZ-HIXSDJFHSA-N |
| XLogP | 5.12 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|