C29H54O6 — CID 123626040
2-(4-ethoxy-4-methyl-3-oxopentan-2-yl)oxy-2,3,3,5,5,7-hexamethyl-7-(2-methyl-3-oxopentan-2-yl)oxynonan-4-one (PubChem CID 123626040) has the molecular formula C29H54O6 and a molecular weight of 498.75 g/mol. Its IUPAC name is 2-(4-ethoxy-4-methyl-3-oxopentan-2-yl)oxy-2,3,3,5,5,7-hexamethyl-7-(2-methyl-3-oxopentan-2-yl)oxynonan-4-one.
| Compound Name | 2-(4-ethoxy-4-methyl-3-oxopentan-2-yl)oxy-2,3,3,5,5,7-hexamethyl-7-(2-methyl-3-oxopentan-2-yl)oxynonan-4-one |
|---|---|
| PubChem CID | 123626040 |
| Molecular Formula | C29H54O6 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | 2-(4-ethoxy-4-methyl-3-oxopentan-2-yl)oxy-2,3,3,5,5,7-hexamethyl-7-(2-methyl-3-oxopentan-2-yl)oxynonan-4-one |
| SMILES | CCOC(C)(C)C(=O)C(C)OC(C)(C)C(C)(C)C(=O)C(C)(C)CC(C)(CC)OC(C)(C)C(=O)CC |
| InChI | InChI=1S/C29H54O6/c1-16-21(30)26(9,10)35-29(15,17-2)19-24(5,6)23(32)25(7,8)28(13,14)34-20(4)22(31)27(11,12)33-18-3/h20H,16-19H2,1-15H3 |
| InChIKey | KVBJVXAXLQUIOH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |