C29H30Br2N6O6 — CID 123628096
(2,4-dibromophenyl) 4-[3-[6-amino-9-[(2R,3S,5S)-5-(2-cyclopropylacetyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 123628096) has the molecular formula C29H30Br2N6O6 and a molecular weight of 718.40 g/mol. Its IUPAC name is (2,4-dibromophenyl) 4-[3-[6-amino-9-[(2R,3S,5S)-5-(2-cyclopropylacetyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | (2,4-dibromophenyl) 4-[3-[6-amino-9-[(2R,3S,5S)-5-(2-cyclopropylacetyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123628096 |
| Molecular Formula | C29H30Br2N6O6 |
| Molecular Weight | 718.40 g/mol |
| Exact Mass | 716.06 |
| IUPAC Name | (2,4-dibromophenyl) 4-[3-[6-amino-9-[(2R,3S,5S)-5-(2-cyclopropylacetyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | Nc1nc(C#CCC2CCN(C(=O)Oc3ccc(Br)cc3Br)CC2)nc2c1ncn2[C@@H]1O[C@H](C(=O)CC2CC2)C(O)[C@@H]1O |
| InChI | InChI=1S/C29H30Br2N6O6/c30-17-6-7-20(18(31)13-17)42-29(41)36-10-8-15(9-11-36)2-1-3-21-34-26(32)22-27(35-21)37(14-33-22)28-24(40)23(39)25(43-28)19(38)12-16-4-5-16/h6-7,13-16,23-25,28,39-40H,2,4-5,8-12H2,(H2,32,34,35)/t23?,24-,25+,28+/m0/s1 |
| InChIKey | PBWCSONHZTXRJN-XKMIWIHUSA-N |
| XLogP | 3.57 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|