C22H23ClFN3O7 — CID 123631082
9-amino-4-(3-chloropropylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123631082) has the molecular formula C22H23ClFN3O7 and a molecular weight of 495.89 g/mol. Its IUPAC name is 9-amino-4-(3-chloropropylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-amino-4-(3-chloropropylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123631082 |
| Molecular Formula | C22H23ClFN3O7 |
| Molecular Weight | 495.89 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 9-amino-4-(3-chloropropylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C(NCCCCl)C2CC3Cc4c(F)cc(N)c(O)c4C(=O)C3C(=O)C2(O)C1=O |
| InChI | InChI=1S/C22H23ClFN3O7/c23-2-1-3-27-15-9-5-7-4-8-10(24)6-11(25)16(28)13(8)17(29)12(7)19(31)22(9,34)20(32)14(18(15)30)21(26)33/h6-7,9,12,14-15,27-28,34H,1-5,25H2,(H2,26,33) |
| InChIKey | CVFFRFMAQPQQPW-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 189.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.89 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|