C16H17N — CID 123631335
N-(1-phenylbuta-1,3-dien-2-yl)hexa-2,5-dien-1-imine (PubChem CID 123631335) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(1-phenylbuta-1,3-dien-2-yl)hexa-2,5-dien-1-imine.
| Compound Name | N-(1-phenylbuta-1,3-dien-2-yl)hexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 123631335 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-(1-phenylbuta-1,3-dien-2-yl)hexa-2,5-dien-1-imine |
| SMILES | C=CCC=C/C=N/C(C=C)=Cc1ccccc1 |
| InChI | InChI=1S/C16H17N/c1-3-5-6-10-13-17-16(4-2)14-15-11-8-7-9-12-15/h3-4,6-14H,1-2,5H2/b10-6?,16-14?,17-13+ |
| InChIKey | FGSSQOOYSYZKMG-SPXBFQNOSA-N |
| XLogP | 4.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|