C15H25N3O4 — CID 123631799
tert-butyl 4-(2-amino-2-oxoethyl)-3-(prop-2-enoxyamino)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 123631799) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl 4-(2-amino-2-oxoethyl)-3-(prop-2-enoxyamino)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-amino-2-oxoethyl)-3-(prop-2-enoxyamino)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 123631799 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | tert-butyl 4-(2-amino-2-oxoethyl)-3-(prop-2-enoxyamino)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CCONC1CN(C(=O)OC(C)(C)C)CC=C1CC(N)=O |
| InChI | InChI=1S/C15H25N3O4/c1-5-8-21-17-12-10-18(14(20)22-15(2,3)4)7-6-11(12)9-13(16)19/h5-6,12,17H,1,7-10H2,2-4H3,(H2,16,19) |
| InChIKey | RPTWCSWVMHBOEC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|