C11H20BNO4 — CID 167461421
[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]boronic acid (PubChem CID 167461421) has the molecular formula C11H20BNO4 and a molecular weight of 241.10 g/mol. Its IUPAC name is [3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]boronic acid.
| Compound Name | [3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]boronic acid |
|---|---|
| PubChem CID | 167461421 |
| Molecular Formula | C11H20BNO4 |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | [3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]boronic acid |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CC=C1B(O)O |
| InChI | InChI=1S/C11H20BNO4/c1-8-7-13(6-5-9(8)12(15)16)10(14)17-11(2,3)4/h5,8,15-16H,6-7H2,1-4H3 |
| InChIKey | IRIXUGAJQLMDJB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|