C19H29NO5 — CID 167462015
tert-butyl 4-[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-3-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 167462015) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is tert-butyl 4-[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-3-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-3-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 167462015 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | tert-butyl 4-[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-3-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CC=C1[C@H]1CC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H29NO5/c1-11-10-20(17(22)25-18(2,3)4)8-7-12(11)13-9-14(21)16-15(13)23-19(5,6)24-16/h7,11,13,15-16H,8-10H2,1-6H3/t11?,13-,15-,16+/m1/s1 |
| InChIKey | ICTZKGOTRCWRNW-VFGUYGFMSA-N |
| XLogP | 2.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|