C19H33NO5 — CID 167460636
tert-butyl 4-[(3aS,4S,6R,6aR)-4-hydroxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-3-methylpiperidine-1-carboxylate (PubChem CID 167460636) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl 4-[(3aS,4S,6R,6aR)-4-hydroxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3aS,4S,6R,6aR)-4-hydroxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167460636 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | tert-butyl 4-[(3aS,4S,6R,6aR)-4-hydroxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-3-methylpiperidine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCC1[C@H]1C[C@H](O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H33NO5/c1-11-10-20(17(22)25-18(2,3)4)8-7-12(11)13-9-14(21)16-15(13)23-19(5,6)24-16/h11-16,21H,7-10H2,1-6H3/t11?,12?,13-,14+,15-,16+/m1/s1 |
| InChIKey | YZZNQHVDQPNULL-RIDGJEOASA-N |
| XLogP | 2.78 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |