C28H37N3O2S — CID 123632899
2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-8-methyl-N-nonylquinolin-4-amine (PubChem CID 123632899) has the molecular formula C28H37N3O2S and a molecular weight of 479.69 g/mol. Its IUPAC name is 2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-8-methyl-N-nonylquinolin-4-amine.
| Compound Name | 2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-8-methyl-N-nonylquinolin-4-amine |
|---|---|
| PubChem CID | 123632899 |
| Molecular Formula | C28H37N3O2S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-8-methyl-N-nonylquinolin-4-amine |
| SMILES | CCCCCCCCCNc1cc(N2CCS(=O)(=O)c3ccccc3C2)nc2c(C)cccc12 |
| InChI | InChI=1S/C28H37N3O2S/c1-3-4-5-6-7-8-11-17-29-25-20-27(30-28-22(2)13-12-15-24(25)28)31-18-19-34(32,33)26-16-10-9-14-23(26)21-31/h9-10,12-16,20H,3-8,11,17-19,21H2,1-2H3,(H,29,30) |
| InChIKey | INZMYWGKJCJOIM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|