C25H34N4O4 — CID 123633073
tert-butyl 4-[cyclopropyl-[hydroxy-[4-(2-methoxypyrimidin-5-yl)phenyl]methyl]amino]piperidine-1-carboxylate (PubChem CID 123633073) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is tert-butyl 4-[cyclopropyl-[hydroxy-[4-(2-methoxypyrimidin-5-yl)phenyl]methyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[cyclopropyl-[hydroxy-[4-(2-methoxypyrimidin-5-yl)phenyl]methyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123633073 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | tert-butyl 4-[cyclopropyl-[hydroxy-[4-(2-methoxypyrimidin-5-yl)phenyl]methyl]amino]piperidine-1-carboxylate |
| SMILES | COc1ncc(-c2ccc(C(O)N(C3CC3)C3CCN(C(=O)OC(C)(C)C)CC3)cc2)cn1 |
| InChI | InChI=1S/C25H34N4O4/c1-25(2,3)33-24(31)28-13-11-21(12-14-28)29(20-9-10-20)22(30)18-7-5-17(6-8-18)19-15-26-23(32-4)27-16-19/h5-8,15-16,20-22,30H,9-14H2,1-4H3 |
| InChIKey | SGGDQISBGJMJIK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|