C17H23N — CID 123633438
(5E)-6-methyl-7-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-1,5-dien-3-imine (PubChem CID 123633438) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (5E)-6-methyl-7-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-1,5-dien-3-imine.
| Compound Name | (5E)-6-methyl-7-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-1,5-dien-3-imine |
|---|---|
| PubChem CID | 123633438 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (5E)-6-methyl-7-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-1,5-dien-3-imine |
| SMILES | [H]/N=C(\C=C)C/C=C(\C)C(C)C1=CC=C(C)CC=C1 |
| InChI | InChI=1S/C17H23N/c1-5-17(18)12-10-14(3)15(4)16-8-6-7-13(2)9-11-16/h5-6,8-11,15,18H,1,7,12H2,2-4H3/b14-10+,18-17+ |
| InChIKey | DXBMSNVHNRCPOU-HXGVTVJWSA-N |
| XLogP | 5.00 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|