C31H46N4O2S — CID 123633657
4-[17-[3-(dimethylamino)propylamino]-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-1-[(5-methyl-1,3-thiazol-2-yl)amino]butan-2-one (PubChem CID 123633657) has the molecular formula C31H46N4O2S and a molecular weight of 538.80 g/mol. Its IUPAC name is 4-[17-[3-(dimethylamino)propylamino]-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-1-[(5-methyl-1,3-thiazol-2-yl)amino]butan-2-one.
| Compound Name | 4-[17-[3-(dimethylamino)propylamino]-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-1-[(5-methyl-1,3-thiazol-2-yl)amino]butan-2-one |
|---|---|
| PubChem CID | 123633657 |
| Molecular Formula | C31H46N4O2S |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | 4-[17-[3-(dimethylamino)propylamino]-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-1-[(5-methyl-1,3-thiazol-2-yl)amino]butan-2-one |
| SMILES | Cc1cnc(NCC(=O)CCC2CC(NCCCN(C)C)C3(C)CCC4c5ccc(O)cc5CCC4C23)s1 |
| InChI | InChI=1S/C31H46N4O2S/c1-20-18-33-30(38-20)34-19-24(37)8-6-22-17-28(32-14-5-15-35(3)4)31(2)13-12-26-25-11-9-23(36)16-21(25)7-10-27(26)29(22)31/h9,11,16,18,22,26-29,32,36H,5-8,10,12-15,17,19H2,1-4H3,(H,33,34) |
| InChIKey | WNVPMKFIYJPOPV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|