C26H23N3O5 — CID 123634747
4-[[(5,7-dimethyl-4-oxochromen-3-yl)methylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoic acid (PubChem CID 123634747) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-[[(5,7-dimethyl-4-oxochromen-3-yl)methylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoic acid.
| Compound Name | 4-[[(5,7-dimethyl-4-oxochromen-3-yl)methylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 123634747 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 4-[[(5,7-dimethyl-4-oxochromen-3-yl)methylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoic acid |
| SMILES | Cc1cc(C)c2c(=O)c(C=NNC(=O)c3ccc(C(=O)O)c(-n4c(C)ccc4C)c3)coc2c1 |
| InChI | InChI=1S/C26H23N3O5/c1-14-9-15(2)23-22(10-14)34-13-19(24(23)30)12-27-28-25(31)18-7-8-20(26(32)33)21(11-18)29-16(3)5-6-17(29)4/h5-13H,1-4H3,(H,28,31)(H,32,33) |
| InChIKey | FNFMELCWYIEIOC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 113.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|