C21H21N3O3 — CID 138510598
4-[[(E)-cyclohexa-2,4-dien-1-ylmethylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoic acid (PubChem CID 138510598) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-[[(E)-cyclohexa-2,4-dien-1-ylmethylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoic acid.
| Compound Name | 4-[[(E)-cyclohexa-2,4-dien-1-ylmethylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 138510598 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-[[(E)-cyclohexa-2,4-dien-1-ylmethylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoic acid |
| SMILES | Cc1ccc(C)n1-c1cc(C(=O)N/N=C/C2C=CC=CC2)ccc1C(=O)O |
| InChI | InChI=1S/C21H21N3O3/c1-14-8-9-15(2)24(14)19-12-17(10-11-18(19)21(26)27)20(25)23-22-13-16-6-4-3-5-7-16/h3-6,8-13,16H,7H2,1-2H3,(H,23,25)(H,26,27)/b22-13+ |
| InChIKey | PAHFVHUHVDUVAB-LPYMAVHISA-N |
| XLogP | 3.64 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|