C27H21F17N2O4 — CID 149012583
2-(2,5-dimethylpyrrol-1-yl)-4-[(6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-2-oxotridecyl)carbamoyl]benzoic acid (PubChem CID 149012583) has the molecular formula C27H21F17N2O4 and a molecular weight of 760.44 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-4-[(6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-2-oxotridecyl)carbamoyl]benzoic acid.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-4-[(6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-2-oxotridecyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 149012583 |
| Molecular Formula | C27H21F17N2O4 |
| Molecular Weight | 760.44 g/mol |
| Exact Mass | 760.12 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-4-[(6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-2-oxotridecyl)carbamoyl]benzoic acid |
| SMILES | Cc1ccc(C)n1-c1cc(C(=O)NCC(=O)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C27H21F17N2O4/c1-12-5-6-13(2)46(12)17-10-14(7-8-16(17)19(49)50)18(48)45-11-15(47)4-3-9-20(28,29)21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)26(40,41)27(42,43)44/h5-8,10H,3-4,9,11H2,1-2H3,(H,45,48)(H,49,50) |
| InChIKey | QBVARHPYLHTYBC-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.44 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|