C17H27FO3Si — CID 123636391
[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(2-fluorophenyl)oxiran-2-yl]methanol (PubChem CID 123636391) has the molecular formula C17H27FO3Si and a molecular weight of 326.48 g/mol. Its IUPAC name is [3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(2-fluorophenyl)oxiran-2-yl]methanol.
| Compound Name | [3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(2-fluorophenyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 123636391 |
| Molecular Formula | C17H27FO3Si |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(2-fluorophenyl)oxiran-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1(c2ccccc2F)OC1CO |
| InChI | InChI=1S/C17H27FO3Si/c1-16(2,3)22(4,5)20-11-10-17(15(12-19)21-17)13-8-6-7-9-14(13)18/h6-9,15,19H,10-12H2,1-5H3 |
| InChIKey | WAUMXSKESVSAIR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|