C38H38N6O7 — CID 123636450
N-[2-[N'-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]diazenyl]carbamimidoyl]-4,5-dimethoxyphenyl]-4-oxochromene-2-carboxamide (PubChem CID 123636450) has the molecular formula C38H38N6O7 and a molecular weight of 690.76 g/mol. Its IUPAC name is N-[2-[N'-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]diazenyl]carbamimidoyl]-4,5-dimethoxyphenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[2-[N'-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]diazenyl]carbamimidoyl]-4,5-dimethoxyphenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 123636450 |
| Molecular Formula | C38H38N6O7 |
| Molecular Weight | 690.76 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | N-[2-[N'-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]diazenyl]carbamimidoyl]-4,5-dimethoxyphenyl]-4-oxochromene-2-carboxamide |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(/N=N/N=C(N)c3cc(OC)c(OC)cc3NC(=O)c3cc(=O)c4ccccc4o3)cc1)CC2 |
| InChI | InChI=1S/C38H38N6O7/c1-47-32-17-24-14-16-44(22-25(24)18-33(32)48-2)15-13-23-9-11-26(12-10-23)41-43-42-37(39)28-19-34(49-3)35(50-4)20-29(28)40-38(46)36-21-30(45)27-7-5-6-8-31(27)51-36/h5-12,17-21H,13-16,22H2,1-4H3,(H,40,46)(H2,39,41,42) |
| InChIKey | ONKUPBWPKMVAEC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 162.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.76 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|