C38H38N6O6 — CID 163415479
N-[4,5-dimethoxy-2-[N'-[[4-[2-(7-methoxy-6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]diazenyl]carbamimidoyl]phenyl]-4-oxochromene-2-carboxamide (PubChem CID 163415479) has the molecular formula C38H38N6O6 and a molecular weight of 674.76 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-[N'-[[4-[2-(7-methoxy-6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]diazenyl]carbamimidoyl]phenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[4,5-dimethoxy-2-[N'-[[4-[2-(7-methoxy-6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]diazenyl]carbamimidoyl]phenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 163415479 |
| Molecular Formula | C38H38N6O6 |
| Molecular Weight | 674.76 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | N-[4,5-dimethoxy-2-[N'-[[4-[2-(7-methoxy-6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]diazenyl]carbamimidoyl]phenyl]-4-oxochromene-2-carboxamide |
| SMILES | COc1cc2c(cc1C)CCN(CCc1ccc(/N=N/N=C(N)c3cc(OC)c(OC)cc3NC(=O)c3cc(=O)c4ccccc4o3)cc1)C2 |
| InChI | InChI=1S/C38H38N6O6/c1-23-17-25-14-16-44(22-26(25)18-33(23)47-2)15-13-24-9-11-27(12-10-24)41-43-42-37(39)29-19-34(48-3)35(49-4)20-30(29)40-38(46)36-21-31(45)28-7-5-6-8-32(28)50-36/h5-12,17-21H,13-16,22H2,1-4H3,(H,40,46)(H2,39,41,42) |
| InChIKey | AEAAKJHKAZPMCW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 153.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.76 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|