C6H9ClN2S — CID 123641180
2-chloro-7-methylsulfanyl-5,6-dihydro-4H-1,3-diazepine (PubChem CID 123641180) has the molecular formula C6H9ClN2S and a molecular weight of 176.67 g/mol. Its IUPAC name is 2-chloro-7-methylsulfanyl-5,6-dihydro-4H-1,3-diazepine.
| Compound Name | 2-chloro-7-methylsulfanyl-5,6-dihydro-4H-1,3-diazepine |
|---|---|
| PubChem CID | 123641180 |
| Molecular Formula | C6H9ClN2S |
| Molecular Weight | 176.67 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 2-chloro-7-methylsulfanyl-5,6-dihydro-4H-1,3-diazepine |
| SMILES | CSC1=NC(Cl)=NCCC1 |
| InChI | InChI=1S/C6H9ClN2S/c1-10-5-3-2-4-8-6(7)9-5/h2-4H2,1H3 |
| InChIKey | LCTXNLMPTNNWJW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.67 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|