C29H34N2O — CID 123646586
1-benzyl-1-(2,2-dimethylcycloheptyl)-3-(1-naphthalen-1-ylethylidene)urea (PubChem CID 123646586) has the molecular formula C29H34N2O and a molecular weight of 426.60 g/mol. Its IUPAC name is 1-benzyl-1-(2,2-dimethylcycloheptyl)-3-(1-naphthalen-1-ylethylidene)urea.
| Compound Name | 1-benzyl-1-(2,2-dimethylcycloheptyl)-3-(1-naphthalen-1-ylethylidene)urea |
|---|---|
| PubChem CID | 123646586 |
| Molecular Formula | C29H34N2O |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1-benzyl-1-(2,2-dimethylcycloheptyl)-3-(1-naphthalen-1-ylethylidene)urea |
| SMILES | CC(=NC(=O)N(Cc1ccccc1)C1CCCCCC1(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H34N2O/c1-22(25-18-12-16-24-15-9-10-17-26(24)25)30-28(32)31(21-23-13-6-4-7-14-23)27-19-8-5-11-20-29(27,2)3/h4,6-7,9-10,12-18,27H,5,8,11,19-21H2,1-3H3 |
| InChIKey | IVAGATIOANNRIW-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|