C20H16FN5O6S3 — CID 123647622
4-[[5-[(5-fluoro-6-phenyl-1,3-benzothiazol-2-yl)-methylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,1-dioxo-2,5-dihydro-1,2,5-thiadiazol-3-ol (PubChem CID 123647622) has the molecular formula C20H16FN5O6S3 and a molecular weight of 537.58 g/mol. Its IUPAC name is 4-[[5-[(5-fluoro-6-phenyl-1,3-benzothiazol-2-yl)-methylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,1-dioxo-2,5-dihydro-1,2,5-thiadiazol-3-ol.
| Compound Name | 4-[[5-[(5-fluoro-6-phenyl-1,3-benzothiazol-2-yl)-methylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,1-dioxo-2,5-dihydro-1,2,5-thiadiazol-3-ol |
|---|---|
| PubChem CID | 123647622 |
| Molecular Formula | C20H16FN5O6S3 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | 4-[[5-[(5-fluoro-6-phenyl-1,3-benzothiazol-2-yl)-methylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,1-dioxo-2,5-dihydro-1,2,5-thiadiazol-3-ol |
| SMILES | CS(=O)(=O)C(c1nnc(CC2=C(O)NS(=O)(=O)N2)o1)c1nc2cc(F)c(-c3ccccc3)cc2s1 |
| InChI | InChI=1S/C20H16FN5O6S3/c1-34(28,29)17(19-24-23-16(32-19)9-14-18(27)26-35(30,31)25-14)20-22-13-8-12(21)11(7-15(13)33-20)10-5-3-2-4-6-10/h2-8,17,25-27H,9H2,1H3 |
| InChIKey | NETKBXWAXCDRLT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |