C23H19FN4O5S3 — CID 90079024
5-[[5-[(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)-propan-2-ylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 90079024) has the molecular formula C23H19FN4O5S3 and a molecular weight of 546.63 g/mol. Its IUPAC name is 5-[[5-[(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)-propan-2-ylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-[(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)-propan-2-ylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90079024 |
| Molecular Formula | C23H19FN4O5S3 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 5-[[5-[(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)-propan-2-ylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)S(=O)(=O)C(c1nnc(CC2SC(=O)NC2=O)o1)c1nc2c(F)cc(-c3ccccc3)cc2s1 |
| InChI | InChI=1S/C23H19FN4O5S3/c1-11(2)36(31,32)19(21-28-27-17(33-21)10-16-20(29)26-23(30)35-16)22-25-18-14(24)8-13(9-15(18)34-22)12-6-4-3-5-7-12/h3-9,11,16,19H,10H2,1-2H3,(H,26,29,30) |
| InChIKey | AMHOMJACMHJSMW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|