C28H17F4N5O4S2 — CID 72945014
N-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-1,3,4-oxadiazol-2-yl]-(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]-4-(trifluoromethyl)benzamide (PubChem CID 72945014) has the molecular formula C28H17F4N5O4S2 and a molecular weight of 627.60 g/mol. Its IUPAC name is N-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-1,3,4-oxadiazol-2-yl]-(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-1,3,4-oxadiazol-2-yl]-(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 72945014 |
| Molecular Formula | C28H17F4N5O4S2 |
| Molecular Weight | 627.60 g/mol |
| Exact Mass | 627.07 |
| IUPAC Name | N-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-1,3,4-oxadiazol-2-yl]-(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C1NC(=O)C(Cc2nnc(C(NC(=O)c3ccc(C(F)(F)F)cc3)c3nc4c(F)cc(-c5ccccc5)cc4s3)o2)S1 |
| InChI | InChI=1S/C28H17F4N5O4S2/c29-17-10-15(13-4-2-1-3-5-13)11-18-21(17)34-26(42-18)22(33-23(38)14-6-8-16(9-7-14)28(30,31)32)25-37-36-20(41-25)12-19-24(39)35-27(40)43-19/h1-11,19,22H,12H2,(H,33,38)(H,35,39,40) |
| InChIKey | VQEZCWFFNWZZTN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|