C30H24FN5O7S3 — CID 90079041
benzyl N-[2-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-1,3,4-oxadiazol-2-yl]-(5-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]sulfonylethyl]carbamate (PubChem CID 90079041) has the molecular formula C30H24FN5O7S3 and a molecular weight of 681.75 g/mol. Its IUPAC name is benzyl N-[2-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-1,3,4-oxadiazol-2-yl]-(5-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]sulfonylethyl]carbamate.
| Compound Name | benzyl N-[2-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-1,3,4-oxadiazol-2-yl]-(5-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]sulfonylethyl]carbamate |
|---|---|
| PubChem CID | 90079041 |
| Molecular Formula | C30H24FN5O7S3 |
| Molecular Weight | 681.75 g/mol |
| Exact Mass | 681.08 |
| IUPAC Name | benzyl N-[2-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-1,3,4-oxadiazol-2-yl]-(5-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]sulfonylethyl]carbamate |
| SMILES | O=C(NCCS(=O)(=O)C(c1nnc(CC2SC(=O)NC2=O)o1)c1nc2cc(F)c(-c3ccccc3)cc2s1)OCc1ccccc1 |
| InChI | InChI=1S/C30H24FN5O7S3/c31-20-14-21-22(13-19(20)18-9-5-2-6-10-18)44-28(33-21)25(27-36-35-24(43-27)15-23-26(37)34-30(39)45-23)46(40,41)12-11-32-29(38)42-16-17-7-3-1-4-8-17/h1-10,13-14,23,25H,11-12,15-16H2,(H,32,38)(H,34,37,39) |
| InChIKey | ZDCKSDZDLTWCMI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 170.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.75 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|